Wikidata entity: Q4639618
C₇H₈IN₃O₄ (P274)
Quantities
| P2067 | mass | 324.956 |
| P233 | canonical SMILES | String | C1=C(C(=O)NC(=O)N1CC(C(=O)O)N)I | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=C(C(=O)NC(=O)N1C[C@@H](C(=O)O)N)I | ??? |
| P129 | physically interacts with | ... | Q21108701 (Glutamate ionotropic receptor kainate type subunit 1) | Glutamate ionotropic receptor kainate type subunit 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 140187-25-3 |
| P683 | ChEBI ID | 43500 |
| P592 | ChEMBL ID | CHEMBL121915 |
| P661 | ChemSpider ID | 394358 |
| P715 | DrugBank ID | DB02818 |
| P8494 | DSSTOX compound identifier | DTXCID90283340 |
| P3117 | DSSTox substance ID | DTXSID90332246 |
| P646 | Freebase ID | /m/04zvd5m |
| P595 | Guide to Pharmacology Ligand ID | 4071 |
| P234 | InChI | InChI=1S/C7H8IN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1 |
| P235 | InChIKey | AXXYLTBQIQBTES-BYPYZUCNSA-N |
| P3636 | PDB ligand ID | IWD |
| P638 | PDB structure ID | 1MQG |
| P638 | PDB structure ID | 1MY4 |
| P638 | PDB structure ID | 3T96 |
| P11199 | Probes And Drugs ID | PD007614 |
| P662 | PubChem CID | 447196 |
| P2877 | SureChEMBL ID | 401659 |
| P2877 | SureChEMBL ID | 13319969 |
| P11089 | UniChem compound ID | 121965 |
Why not click here or view trends?
log id: 2128396