Abstract is: 6,6'-Bieckol is an eckol-type phlorotannin found in the brown algae Ecklonia cava and Ecklonia stolonifera.
| P233 | canonical SMILES | C1=C(C=C(C=C1O)OC2=C(C=C(C3=C2OC4=C(C=C(C(=C4O3)C5=C6C(=C(C=C5O)O)OC7=C(O6)C(=CC(=C7OC8=CC(=CC(=C8)O)O)O)O)O)O)O)O)O |
| P231 | CAS Registry Number | 88095-81-2 |
| P683 | ChEBI ID | 65496 |
| P592 | ChEMBL ID | CHEMBL502202 |
| P661 | ChemSpider ID | 121062 |
| P8494 | DSSTOX compound identifier | DTXCID80159303 |
| P3117 | DSSTox substance ID | DTXSID50236812 |
| P646 | Freebase ID | /m/0p3js75 |
| P234 | InChI | InChI=1S/C36H22O18/c37-11-1-12(38)4-15(3-11)49-29-21(45)9-23(47)31-35(29)53-27-19(43)7-17(41)25(33(27)51-31)26-18(42)8-20(44)28-34(26)52-32-24(48)10-22(46)30(36(32)54-28)50-16-5-13(39)2-14(40)6-16/h1-10,37-48H |
| P235 | InChIKey | HBJNTPFHQKXWOY-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00048591 |
| P662 | PubChem CID | 137388 |
| P1579 | Reaxys registry number | 5713463 |
| P11089 | UniChem compound ID | 400838 |
| P652 | UNII | 87U82W6IFI |
| P703 | found in taxon | Ecklonia kurome | Q657616 |
| Ecklonia cava | Q5332922 | ||
| P2067 | mass | 742.081 |
| Q39404220 | 6,6'-Bieckol, isolated from marine alga Ecklonia cava, suppressed LPS-induced nitric oxide and PGE₂ production and inflammatory cytokine expression in macrophages: the inhibition of NFκB. |
| Q34806713 | Anti-HIV-1 activity of phloroglucinol derivative, 6,6'-bieckol, from Ecklonia cava. |
| Q34479847 | Anti-plasmin inhibitor. V. Structures of novel dimeric eckols isolated from the brown alga Ecklonia kurome OKAMURA. |
| Q34939813 | Chemical components and its antioxidant properties in vitro: an edible marine brown alga, Ecklonia cava |
| Q35675486 | Evaluation of antioxidant properties of a new compound, pyrogallol-phloroglucinol-6,6'-bieckol isolated from brown algae, Ecklonia cava |
| Q39743649 | Inhibition of the expression on MMP-2, 9 and morphological changes via human fibrosarcoma cell line by 6,6'-bieckol from marine alga Ecklonia cava |
| 6,6'-Bieckol | wikipedia | |
| Serbo-Croatian (sh / Q9301) | 6,6'-Biekol | wikipedia |
| 6,6'-Biekol | wikipedia |
Search more.