Wikidata entity: Q4651471
C₂₇H₃₈N₆O₂ (P274)
Quantities
| P2067 | mass | 478.305624 |
| P233 | canonical SMILES | String | CCCN(CCC)CC1CCCCN1CCNC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q4847907 (Cholinergic receptor muscarinic 4) | Cholinergic receptor muscarinic 4 |
| P129 | physically interacts with | ... | Q4847910 (Cholinergic receptor muscarinic 2) | Cholinergic receptor muscarinic 2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q3363684 (parasympatholytic) | parasympatholytic |
| P231 | CAS Registry Number | 118290-27-0 |
| P683 | ChEBI ID | 110176 |
| P592 | ChEMBL ID | CHEMBL279453 |
| P661 | ChemSpider ID | 106608 |
| P8494 | DSSTOX compound identifier | DTXCID301351532 |
| P3117 | DSSTox substance ID | DTXSID60922653 |
| P646 | Freebase ID | /m/0h3qzz4 |
| P595 | Guide to Pharmacology Ligand ID | 3264 |
| P595 | Guide to Pharmacology Ligand ID | 368 |
| P234 | InChI | InChI=1S/C27H38N6O2/c1-3-16-31(17-4-2)20-21-10-7-8-18-32(21)19-15-29-27(35)33-24-13-6-5-11-22(24)26(34)30-23-12-9-14-28-25(23)33/h5-6,9,11-14,21H,3-4,7-8,10,15-20H2,1-2H3,(H,29,35)(H,30,34) |
| P235 | InChIKey | MZDYABXXPZNUCT-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C065959 |
| P6366 | Microsoft Academic ID (discontinued) | 2778221856 |
| P11199 | Probes And Drugs ID | PD048138 |
| P662 | PubChem CID | 119357 |
| P2877 | SureChEMBL ID | 29462354 |
| P2877 | SureChEMBL ID | 29470062 |
| P2877 | SureChEMBL ID | 9824222 |
| P11089 | UniChem compound ID | 18042 |
| P652 | UNII | KFR8EX22KX |
Why not click here or view trends?
log id: 2724987