Wikidata entity: Q4653190
C₂₆H₃₄ClN₆O₂P (P274)
Quantities
| P2067 | mass | 528.216939 |
| P233 | canonical SMILES | String | CN(C)C1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4P(=O)(C)C)Cl)OC | ??? |
| P1889 | different from | ... | Q27456393 (brigatinib) | brigatinib |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P8026 | LiverTox likelihood score | ... | Q83284878 (Լյարդի ախտահարման հավանականության E կատեգորիա) | Լյարդի ախտահարման հավանականության E կատեգորիա |
| P129 | physically interacts with | ... | Q422579 (insulin receptor) | insulin receptor |
| P129 | physically interacts with | ... | Q424401 (epidermal growth factor receptor) | epidermal growth factor receptor |
| P129 | physically interacts with | ... | Q2005209 (insulin like growth factor 1 receptor) | insulin like growth factor 1 receptor |
| P129 | physically interacts with | ... | Q21111336 (ALK receptor tyrosine kinase) | ALK receptor tyrosine kinase |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P267 | ATC code | L01XE43 |
| P231 | CAS Registry Number | 1197958-12-5 |
| P592 | ChEMBL ID | CHEMBL3397300 |
| P661 | ChemSpider ID | 29315008 |
| P8494 | DSSTOX compound identifier | DTXCID80676161 |
| P3117 | DSSTox substance ID | DTXSID30725416 |
| P2057 | Human Metabolome Database ID | HMDB0242456 |
| P234 | InChI | InChI=1S/C26H34ClN6O2P/c1-32(2)18-12-14-33(15-13-18)19-10-11-21(23(16-19)35-3)30-26-28-17-20(27)25(31-26)29-22-8-6-7-9-24(22)36(4,5)34/h6-11,16-18H,12-15H2,1-5H3,(H2,28,29,30,31) |
| P235 | InChIKey | OVDSPTSBIQCAIN-UHFFFAOYSA-N |
| P3636 | PDB ligand ID | E5J |
| P11199 | Probes And Drugs ID | PD010656 |
| P662 | PubChem CID | 57390074 |
| P2877 | SureChEMBL ID | 11916416 |
| P11089 | UniChem compound ID | 32051878 |
| P652 | UNII | 3DGD69C6PV |
Why not click here or view trends?
log id: 3459689