Wikidata entity: Q4673284
C₂₃H₂₉N₃O₂S (P274)
Quantities
| P4250 | defined daily dose | 50 |
| P2067 | mass | 411.198048 |
| P233 | canonical SMILES | String | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN4CCN(CC4)CCO | ??? |
| P373 | Commons category | String | Acetophenazine | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q2157462 (schizophreniform disorder) | schizophreniform disorder |
| P2175 | medical condition treated | ... | Q41112 (schizophrenia) | schizophrenia |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q3271533 (dopamine antagonist) | dopamine antagonist |
| P2868 | subject has role | ... | Q1927838 (alpha blocker) | alpha blocker |
| P267 | ATC code | N05AB07 |
| P231 | CAS Registry Number | 2751-68-0 |
| P683 | ChEBI ID | 2401 |
| P592 | ChEMBL ID | CHEMBL1085 |
| P661 | ChemSpider ID | 16708 |
| P715 | DrugBank ID | DB01063 |
| P11198 | DrugCentral ID | 59 |
| P8494 | DSSTOX compound identifier | DTXCID202547 |
| P3117 | DSSTox substance ID | DTXSID2022547 |
| P646 | Freebase ID | /m/0g8_32 |
| P2057 | Human Metabolome Database ID | HMDB0015196 |
| P234 | InChI | InChI=1S/C23H29N3O2S/c1-18(28)19-7-8-23-21(17-19)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)15-16-27/h2-3,5-8,17,27H,4,9-16H2,1H3 |
| P235 | InChIKey | WNTYBHLDCKXEOT-UHFFFAOYSA-N |
| P665 | KEGG ID | C06807 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP003081 |
| P6694 | MeSH concept ID | M0262855 |
| P6366 | Microsoft Academic ID (discontinued) | 2776518445 |
| P2115 | NDF-RT ID | N0000147689 |
| P11199 | Probes And Drugs ID | PD009571 |
| P662 | PubChem CID | 17676 |
| P1579 | Reaxys registry number | 57631 |
| P3345 | RxNorm CUI | 16735 |
| P4964 | SPLASH | splash10-0h2f-7962200000-29f2e9055979e0add70b |
| P2877 | SureChEMBL ID | 94266 |
| P2892 | UMLS CUI | C0050458 |
| P11089 | UniChem compound ID | 551909 |
| P652 | UNII | 8620H6K4QH |
Why not click here or view trends?
log id: 5923331