Wikidata entity: Q487463
C₁₅H₁₃ClN₄O₂S₂ (P274)
Quantities
| P2067 | mass | 380.016845 |
| P233 | canonical SMILES | String | C1=CC=C2C(=C1)C(=CN2S(=O)(=O)C3=C(N=C4N3C=CS4)Cl)CCN | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21109363 (5-hydroxytryptamine receptor 6) | 5-hydroxytryptamine receptor 6 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 554403-49-5 |
| P592 | ChEMBL ID | CHEMBL392760 |
| P661 | ChemSpider ID | 8326005 |
| P8494 | DSSTOX compound identifier | DTXCID50126502 |
| P3117 | DSSTox substance ID | DTXSID50204011 |
| P646 | Freebase ID | /m/0bmk0s8 |
| P595 | Guide to Pharmacology Ligand ID | 3240 |
| P234 | InChI | InChI=1S/C15H13ClN4O2S2/c16-13-14(19-7-8-23-15(19)18-13)24(21,22)20-9-10(5-6-17)11-3-1-2-4-12(11)20/h1-4,7-9H,5-6,17H2 |
| P235 | InChIKey | RYBOXBBYCVOYNO-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD048404 |
| P662 | PubChem CID | 10150497 |
| P2877 | SureChEMBL ID | 801436 |
| P11089 | UniChem compound ID | 538401 |
| P652 | UNII | WXE3H7W295 |
Why not click here or view trends?
log id: 2384432