C₂₅H₂₇N₃O₄ (P274)
Quantities
| P2067 | mass | 433.2 |
| P233 | canonical SMILES | String | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C5=CC=CC=C5N=C4C3=C2)CCNC(C)C)O | ??? |
| P373 | Commons category | String | Belotecan | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C5=CC=CC=C5N=C4C3=C2)CCNC(C)C)O | ??? |
| P2175 | medical condition treated | ... | Q19000544 (lung small cell carcinoma) | lung small cell carcinoma |
| P2175 | medical condition treated | ... | Q172341 (ovarian cancer) | ovarian cancer |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q50377179 (topoisomerase I inhibitor) | topoisomerase I inhibitor |
| P231 | CAS Registry Number | 256411-32-2 |
| P683 | ChEBI ID | 135702 |
| P592 | ChEMBL ID | CHEMBL2111084 |
| P661 | ChemSpider ID | 4958253 |
| P715 | DrugBank ID | DB12459 |
| P11198 | DrugCentral ID | 296 |
| P8494 | DSSTOX compound identifier | DTXCID70102823 |
| P3117 | DSSTox substance ID | DTXSID60180332 |
| P646 | Freebase ID | /m/04zyr6c |
| P234 | InChI | InChI=1S/C25H27N3O4/c1-4-25(31)19-11-21-22-17(12-28(21)23(29)18(19)13-32-24(25)30)15(9-10-26-14(2)3)16-7-5-6-8-20(16)27-22/h5-8,11,14,26,31H,4,9-10,12-13H2,1-3H3/t25-/m0/s1 |
| P235 | InChIKey | LNHWXBUNXOXMRL-VWLOTQADSA-N |
| P486 | MeSH descriptor ID | C116963 |
| P11199 | Probes And Drugs ID | PD072532 |
| P662 | PubChem CID | 6456014 |
| P2877 | SureChEMBL ID | 18983 |
| P11089 | UniChem compound ID | 27301019 |
| P652 | UNII | 27Z82M2G1N |
Why not click here or view trends?
log id: 2724221