Wikidata entity: Q48862264
C₂₅H₃₅N₃O₂ (P274)
Quantities
| P2067 | mass | 409.27292736000004 |
| P233 | canonical SMILES | String | CC1(CCC2C(C1)CCC3C2CCC4(C3CCC4C(=O)CN5C=C(C=N5)C#N)C)O | ??? |
| P373 | Commons category | String | Zuranolone | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@]1(CC[C@H]2[C@@H](C1)CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4C(=O)CN5C=C(C=N5)C#N)C)O | ??? |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1632051-40-1 |
| P683 | ChEBI ID | 228302 |
| P661 | ChemSpider ID | 71117610 |
| P715 | DrugBank ID | DB15490 |
| P3117 | DSSTox substance ID | DTXSID601128500 |
| P232 | EC number | 835-313-9 |
| P2566 | ECHA Substance Infocard ID | 100.271.331 |
| P2671 | Google Knowledge Graph ID | /g/11hbv8yq58 |
| P234 | InChI | InChI=1S/C25H35N3O2/c1-24(30)9-7-18-17(11-24)3-4-20-19(18)8-10-25(2)21(20)5-6-22(25)23(29)15-28-14-16(12-26)13-27-28/h13-14,17-22,30H,3-11,15H2,1-2H3/t17-,18+,19-,20-,21+,22-,24-,25+/m1/s1 |
| P235 | InChIKey | HARRKNSQXBRBGZ-GVKWWOCJSA-N |
| P662 | PubChem CID | 86294073 |
| P2877 | SureChEMBL ID | 16189866 |
| P11089 | UniChem compound ID | 83924892 |
| P652 | UNII | 7ZW49N180B |
| P11143 | WikiProjectMed ID | Zuranolone |
Why not click here or view trends?
log id: 2765147