Wikidata entity: Q4973749
C₂₁H₂₃BrFNO₂ (P274)
Quantities
| P4250 | defined daily dose | 3.3 |
| P4250 | defined daily dose | 10 |
| P2067 | mass | 419.09 |
| P233 | canonical SMILES | String | C1CN(CCC1(C2=CC=C(C=C2)Br)O)CCCC(=O)C3=CC=C(C=C3)F | ??? |
| P373 | Commons category | String | Bromperidol | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q208144 (antipsychotics) | antipsychotics |
| P267 | ATC code | N05AD06 |
| P231 | CAS Registry Number | 10457-90-6 |
| P683 | ChEBI ID | 31305 |
| P592 | ChEMBL ID | CHEMBL28218 |
| P661 | ChemSpider ID | 2354 |
| P715 | DrugBank ID | DB12401 |
| P11198 | DrugCentral ID | 407 |
| P8494 | DSSTOX compound identifier | DTXCID102690 |
| P3117 | DSSTox substance ID | DTXSID0022690 |
| P232 | EC number | 233-943-3 |
| P2566 | ECHA Substance Infocard ID | 100.030.845 |
| P646 | Freebase ID | /m/026k6_c |
| P234 | InChI | InChI=1S/C21H23BrFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 |
| P235 | InChIKey | RKLNONIVDFXQRX-UHFFFAOYSA-N |
| P665 | KEGG ID | D01101 |
| P486 | MeSH descriptor ID | C006820 |
| P6366 | Microsoft Academic ID (discontinued) | 2781373138 |
| P2840 | NSC number | 759275 |
| P11199 | Probes And Drugs ID | PD000252 |
| P662 | PubChem CID | 2448 |
| P3345 | RxNorm CUI | 19777 |
| P2877 | SureChEMBL ID | 43755 |
| P11089 | UniChem compound ID | 575445 |
| P652 | UNII | LYH6F7I22E |
Why not click here or view trends?
log id: 2676816