Wikidata entity: Q5037673
C₁₈H₂₇NO₂ (P274)
Quantities
| P2067 | mass | 289.204 |
| P233 | canonical SMILES | String | CCN(CC)CCOC(=O)C1(CCCC1)C2=CC=CC=C2 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q35805 (cough) | cough |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 77-22-5 |
| P683 | ChEBI ID | 135204 |
| P592 | ChEMBL ID | CHEMBL61946 |
| P661 | ChemSpider ID | 6228 |
| P715 | DrugBank ID | DB11504 |
| P11198 | DrugCentral ID | 486 |
| P8494 | DSSTOX compound identifier | DTXCID802729 |
| P3117 | DSSTox substance ID | DTXSID0022729 |
| P232 | EC number | 201-013-6 |
| P2566 | ECHA Substance Infocard ID | 100.000.922 |
| P646 | Freebase ID | /m/0n46z96 |
| P2057 | Human Metabolome Database ID | HMDB0249602 |
| P234 | InChI | InChI=1S/C18H27NO2/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 |
| P235 | InChIKey | OFAIGZWCDGNZGT-UHFFFAOYSA-N |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP002787 |
| P6366 | Microsoft Academic ID (discontinued) | 2781040944 |
| P2115 | NDF-RT ID | N0000147745 |
| P11199 | Probes And Drugs ID | PD014098 |
| P662 | PubChem CID | 6472 |
| P3345 | RxNorm CUI | 20191 |
| P4964 | SPLASH | splash10-000i-9200000000-e8cc4f4a84fe6283a06c |
| P2877 | SureChEMBL ID | 181285 |
| P2892 | UMLS CUI | C0054635 |
| P11089 | UniChem compound ID | 217472 |
| P652 | UNII | 97J7NP0XJY |
Why not click here or view trends?
log id: 3383865