Wikidata entity: Q5064514
C₂₂H₂₃N₃O₃S (P274)
Quantities
| P2067 | mass | 409.146013 |
| P233 | canonical SMILES | String | CN(C)CCCOC1=CC2=C(NN=C2C=C1)S(=O)(=O)C3=CC=CC4=CC=CC=C43 | ??? |
| P373 | Commons category | String | Cerlapirdine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21109363 (5-hydroxytryptamine receptor 6) | 5-hydroxytryptamine receptor 6 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 925448-93-7 |
| P592 | ChEMBL ID | CHEMBL2103880 |
| P661 | ChemSpider ID | 17231095 |
| P715 | DrugBank ID | DB12229 |
| P3117 | DSSTox substance ID | DTXSID201137232 |
| P646 | Freebase ID | /m/0hgps_x |
| P595 | Guide to Pharmacology Ligand ID | 7356 |
| P234 | InChI | InChI=1S/C22H23N3O3S/c1-25(2)13-6-14-28-17-11-12-20-19(15-17)22(24-23-20)29(26,27)21-10-5-8-16-7-3-4-9-18(16)21/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,23,24) |
| P235 | InChIKey | NXQGEDVQXVTCDA-UHFFFAOYSA-N |
| P665 | KEGG ID | D10099 |
| P11199 | Probes And Drugs ID | PD050682 |
| P662 | PubChem CID | 16071605 |
| P2877 | SureChEMBL ID | 3534330 |
| P2877 | SureChEMBL ID | 21381542 |
| P2877 | SureChEMBL ID | 29375645 |
| P11089 | UniChem compound ID | 1076755 |
| P652 | UNII | EK40PJ0V49 |
Why not click here or view trends?
log id: 2753676