Wikidata entity: Q5104342
C₁₂H₂₁N₅O₃ (P274)
Quantities
| P2067 | mass | 283.164439532 |
| P233 | canonical SMILES | String | CN1C(=O)N(C)c2nc[n-]c2C1=O.C[N+](C)(C)CCO | ??? |
| P373 | Commons category | String | Choline theophyllinate | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q35869 (asthma) | asthma |
| P2175 | medical condition treated | ... | Q188605 (pulmonary emphysema) | pulmonary emphysema |
| P2175 | medical condition treated | ... | Q217111 (bradycardia) | bradycardia |
| P2175 | medical condition treated | ... | Q1900400 (acute bronchitis) | acute bronchitis |
| P1748 | NCI Thesaurus ID | String | C47645 | ??? |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q418251 (phosphodiesterase inhibitor) | phosphodiesterase inhibitor |
| P2868 | subject has role | ... | Q927234 (bronchodilator) | bronchodilator |
| P267 | ATC code | R03DA02 |
| P231 | CAS Registry Number | 4499-40-5 |
| P592 | ChEMBL ID | CHEMBL1200434 |
| P661 | ChemSpider ID | 25044543 |
| P715 | DrugBank ID | DB01303 |
| P8494 | DSSTOX compound identifier | DTXCID401324429 |
| P3117 | DSSTox substance ID | DTXSID20894867 |
| P232 | EC number | 224-798-7 |
| P2566 | ECHA Substance Infocard ID | 100.022.545 |
| P646 | Freebase ID | /m/0cx5q8 |
| P234 | InChI | InChI=1S/C7H8N4O2.C5H14NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-6(2,3)4-5-7/h3H,1-2H3,(H,8,9,12);7H,4-5H2,1-3H3/q;+1/p-1 |
| P235 | InChIKey | RLANKEDHRWMNRO-UHFFFAOYSA-M |
| P665 | KEGG ID | D02017 |
| P486 | MeSH descriptor ID | C012839 |
| P6366 | Microsoft Academic ID (discontinued) | 2780105020 |
| P2115 | NDF-RT ID | N0000146943 |
| P2840 | NSC number | 760431 |
| P11199 | Probes And Drugs ID | PD000293 |
| P662 | PubChem CID | 656652 |
| P3345 | RxNorm CUI | 20976 |
| P2877 | SureChEMBL ID | 152854 |
| P11089 | UniChem compound ID | 45425568 |
| P652 | UNII | 3K045XR58X |
Why not click here or view trends?
log id: 947933