Wikidata entity: Q5135028
C₁₃H₁₁ClN₂O₂ (P274)

Quantities
| P2067 | mass | 262.051 |
| P233 | canonical SMILES | String | CC1=C(C=CC=C1Cl)NC2=C(C=CC=N2)C(=O)O | ??? |
| P1552 | has characteristic | ... | Q1517187 (bitterness) | bitterness |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q133823 (migraine) | migraine |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q188724 (non-steroidal anti-inflammatory drug) | non-steroidal anti-inflammatory drug |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | clonixin | ??? |
| P231 | CAS Registry Number | 17737-65-4 |
| P683 | ChEBI ID | 76200 |
| P592 | ChEMBL ID | CHEMBL1332971 |
| P661 | ChemSpider ID | 26711 |
| P715 | DrugBank ID | DB09218 |
| P11198 | DrugCentral ID | 705 |
| P8494 | DSSTOX compound identifier | DTXCID0026121 |
| P3117 | DSSTox substance ID | DTXSID2046121 |
| P232 | EC number | 241-730-1 |
| P2566 | ECHA Substance Infocard ID | 100.037.921 |
| P646 | Freebase ID | /m/0661034 |
| P2057 | Human Metabolome Database ID | HMDB0250352 |
| P234 | InChI | InChI=1S/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18) |
| P235 | InChIKey | CLOMYZFHNHFSIQ-UHFFFAOYSA-N |
| P665 | KEGG ID | D03555 |
| P486 | MeSH descriptor ID | D003002 |
| P672 | MeSH tree code | D03.066.515.375 |
| P672 | MeSH tree code | D03.383.725.547.375 |
| P6366 | Microsoft Academic ID (discontinued) | 2779636894 |
| P2840 | NSC number | 335505 |
| P3636 | PDB ligand ID | 6J3 |
| P638 | PDB structure ID | 5L4I |
| P11199 | Probes And Drugs ID | PD000098 |
| P662 | PubChem CID | 28718 |
| P1579 | Reaxys registry number | 483212 |
| P3345 | RxNorm CUI | 2601 |
| P2877 | SureChEMBL ID | 121785 |
| P11089 | UniChem compound ID | 881961 |
| P652 | UNII | V7DXN0M42R |
Why not click here or view trends?
log id: 6311897