Wikidata entity: Q5332458
C₅₂H₈₁N₇O₁₆ (P274)
Quantities
| P2067 | mass | 1059.573979512 |
| P233 | canonical SMILES | String | CCCCCC=CCC=CCCCCCCCC(=O)NC1CC(C(NC(=O)C2C(C(CN2C(=O)C(NC(=O)C(NC(=O)C3CC(CN3C(=O)C(NC1=O)C(C)O)O)C(C(C4=CC=C(C=C4)O)O)O)C(C)O)C)O)O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@H]1C[C@H]([C@H](NC(=O)[C@@H]2[C@H]([C@H](CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@@H](NC1=O)[C@H](C)O)O)[C@@H]([C@H](C4=CC=C(C=C4)O)O)O)[C@H](C)O)C)O)O)O | ??? |
| P3364 | stereoisomer of | ... | Q104992442 (echinocandin B) | echinocandin B |
| P279 | subclass of | ... | Q109559114 (biogenic cyclopeptide) | biogenic cyclopeptide |
Why not click here or view trends?
log id: 3035003