Wikidata entity: Q5375164
C₂₄H₃₂N₂O₃ (P274)

Quantities
| P2067 | mass | 396.241 |
| P233 | canonical SMILES | String | CN(C1CCC2(CCCO2)CC1N3CCCC3)C(=O)CC4=C5C=COC5=CC=C4 | ??? |
| P373 | Commons category | String | Enadoline | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)CC4=C5C=COC5=CC=C4 | ??? |
| P129 | physically interacts with | ... | Q8083989 (opioid receptor kappa 1) | opioid receptor kappa 1 |
| P5555 | schematic | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Enadoline%20synthesis.png | ??? |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q241549 (antiarrhythmic agent) | antiarrhythmic agent |
| P2868 | subject has role | ... | Q50377190 (neuroprotective agent) | neuroprotective agent |
| P231 | CAS Registry Number | 124378-77-4 |
| P592 | ChEMBL ID | CHEMBL318859 |
| P661 | ChemSpider ID | 54765 |
| P715 | DrugBank ID | DB16967 |
| P8494 | DSSTOX compound identifier | DTXCID2027258 |
| P3117 | DSSTox substance ID | DTXSID4047258 |
| P646 | Freebase ID | /m/03ctkfc |
| P595 | Guide to Pharmacology Ligand ID | 3475 |
| P595 | Guide to Pharmacology Ligand ID | 1646 |
| P2062 | HSDB ID | 7677 |
| P234 | InChI | InChI=1S/C24H32N2O3/c1-25(23(27)16-18-6-4-7-22-19(18)9-15-28-22)20-8-11-24(10-5-14-29-24)17-21(20)26-12-2-3-13-26/h4,6-7,9,15,20-21H,2-3,5,8,10-14,16-17H2,1H3/t20-,21-,24-/m0/s1 |
| P235 | InChIKey | JMBYBVLCYODBJQ-HFMPRLQTSA-N |
| P486 | MeSH descriptor ID | C067110 |
| P6366 | Microsoft Academic ID (discontinued) | 2776354627 |
| P11199 | Probes And Drugs ID | PD046781 |
| P662 | PubChem CID | 60768 |
| P2877 | SureChEMBL ID | 220053 |
| P11089 | UniChem compound ID | 600366 |
| P652 | UNII | KJL283326C |
Why not click here or view trends?
log id: 2746721