Wikidata entity: Q5402458
C₁₄H₁₉N₅O₂ (P274)
Quantities
| P2067 | mass | 289.153875 |
| P233 | canonical SMILES | String | CCN1C2=NC=C(C(=C2C=N1)NN=C(C)C)C(=O)OCC | ??? |
| P373 | Commons category | String | Etazolate | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21113312 (Gamma-aminobutyric acid type A receptor subunit beta3) | Gamma-aminobutyric acid type A receptor subunit beta3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q208144 (antipsychotics) | antipsychotics |
| P2868 | subject has role | ... | Q418251 (phosphodiesterase inhibitor) | phosphodiesterase inhibitor |
| P231 | CAS Registry Number | 51022-77-6 |
| P683 | ChEBI ID | 138502 |
| P592 | ChEMBL ID | CHEMBL356388 |
| P661 | ChemSpider ID | 3162 |
| P8494 | DSSTOX compound identifier | DTXCID0028408 |
| P3117 | DSSTox substance ID | DTXSID4048434 |
| P646 | Freebase ID | /m/03y07k2 |
| P595 | Guide to Pharmacology Ligand ID | 7336 |
| P2057 | Human Metabolome Database ID | HMDB0251990 |
| P234 | InChI | InChI=1S/C14H19N5O2/c1-5-19-13-10(8-16-19)12(18-17-9(3)4)11(7-15-13)14(20)21-6-2/h7-8H,5-6H2,1-4H3,(H,15,18) |
| P235 | InChIKey | OPQRBXUBWHDHPQ-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | D004974 |
| P672 | MeSH tree code | D03.066.515.400 |
| P672 | MeSH tree code | D03.383.725.547.400 |
| P6366 | Microsoft Academic ID (discontinued) | 2779971846 |
| P11199 | Probes And Drugs ID | PD013531 |
| P662 | PubChem CID | 3277 |
| P2877 | SureChEMBL ID | 123840 |
| P11089 | UniChem compound ID | 387806 |
| P652 | UNII | I89Y79062L |
Why not click here or view trends?
log id: 2074792