C₂₂H₂₆FN₃O₄ (P274)
Quantities
| P2067 | mass | 415.190735 |
| P233 | canonical SMILES | String | C1CN(CCN1CCNC(=O)C2=CC=C(C=C2)F)C3=C4C(=CC=C3)OC(CO4)CO | ??? |
| P373 | Commons category | String | Flesinoxan | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1CN(CCN1CCNC(=O)C2=CC=C(C=C2)F)C3=C4C(=CC=C3)O[C@H](CO4)CO | ??? |
| P129 | physically interacts with | ... | Q21115043 (5-hydroxytryptamine receptor 1A) | 5-hydroxytryptamine receptor 1A |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q76560 (antidepressant) | antidepressant |
| P2868 | subject has role | ... | Q575890 (antihypertensive drug) | antihypertensive drug |
| P2868 | subject has role | ... | Q7455050 (serotonin receptor agonists) | serotonin receptor agonists |
| P2868 | subject has role | ... | Q62903 (anxiolytic) | anxiolytic |
| P231 | CAS Registry Number | 98206-10-1 |
| P592 | ChEMBL ID | CHEMBL1742477 |
| P661 | ChemSpider ID | 51700 |
| P646 | Freebase ID | /m/047mjln |
| P595 | Guide to Pharmacology Ligand ID | 1 |
| P234 | InChI | InChI=1S/C22H26FN3O4/c23-17-6-4-16(5-7-17)22(28)24-8-9-25-10-12-26(13-11-25)19-2-1-3-20-21(19)29-15-18(14-27)30-20/h1-7,18,27H,8-15H2,(H,24,28)/t18-/m0/s1 |
| P235 | InChIKey | NYSDRDDQELAVKP-SFHVURJKSA-N |
| P665 | KEGG ID | D02568 |
| P486 | MeSH descriptor ID | C056895 |
| P6366 | Microsoft Academic ID (discontinued) | 2779332888 |
| P11199 | Probes And Drugs ID | PD048530 |
| P662 | PubChem CID | 57347 |
| P2877 | SureChEMBL ID | 220401 |
| P11089 | UniChem compound ID | 1078040 |
| P652 | UNII | 3V574S89E1 |
Why not click here or view trends?
log id: 4558684