Wikidata entity: Q5462983
C₁₉H₁₆ClFN₂O (P274)
Quantities
| P2067 | mass | 342.094 |
| P233 | canonical SMILES | String | C1CC1CN2C(=O)CN=C(C3=C2C=CC(=C3)Cl)C4=CC=CC=C4F | ??? |
| P373 | Commons category | String | Flutoprazepam | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q177190 (sleep disorder) | sleep disorder |
| P2175 | medical condition treated | ... | Q188638 (mood disorder) | mood disorder |
| P2175 | medical condition treated | ... | Q544006 (anxiety disorder) | anxiety disorder |
| P3489 | pregnancy category | ... | Q28123619 (US pregnancy category X) | US pregnancy category X |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 25967-29-7 |
| P683 | ChEBI ID | 31629 |
| P592 | ChEMBL ID | CHEMBL2106743 |
| P661 | ChemSpider ID | 3283 |
| P11198 | DrugCentral ID | 1226 |
| P8494 | DSSTOX compound identifier | DTXCID60103122 |
| P3117 | DSSTox substance ID | DTXSID20180631 |
| P646 | Freebase ID | /m/03c3_hz |
| P234 | InChI | InChI=1S/C19H16ClFN2O/c20-13-7-8-17-15(9-13)19(14-3-1-2-4-16(14)21)22-10-18(24)23(17)11-12-5-6-12/h1-4,7-9,12H,5-6,10-11H2 |
| P235 | InChIKey | OFVXPDXXVSGEPX-UHFFFAOYSA-N |
| P8408 | KBpedia ID | Flutoprazepam |
| P665 | KEGG ID | D01279 |
| P6366 | Microsoft Academic ID (discontinued) | 2778002010 |
| P11199 | Probes And Drugs ID | PD072758 |
| P662 | PubChem CID | 3400 |
| P2877 | SureChEMBL ID | 124578 |
| P11089 | UniChem compound ID | 1074899 |
| P652 | UNII | 2GHY1101MM |
Why not click here or view trends?
log id: 2720347