Wikidata entity: Q5514388
C₁₉H₂₇N₃O₄S (P274)
Quantities
| P2067 | mass | 393.172227 |
| P233 | canonical SMILES | String | CN1C=C(C2=CC=CC=C21)C(=O)OCC3CCN(CC3)CCNS(=O)(=O)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21109365 (5-hydroxytryptamine receptor 4) | 5-hydroxytryptamine receptor 4 |
| P129 | physically interacts with | ... | Q21497941 (5 hydroxytryptamine (serotonin) receptor 4) | 5 hydroxytryptamine (serotonin) receptor 4 |
| P279 | subclass of | ... | Q134856 (carboxylic acid) | carboxylic acid |
| P2868 | subject has role | ... | Q7455047 (serotonin antagonist) | serotonin antagonist |
| P231 | CAS Registry Number | 144625-51-4 |
| P683 | ChEBI ID | 73380 |
| P592 | ChEMBL ID | CHEMBL33884 |
| P661 | ChemSpider ID | 106623 |
| P8494 | DSSTOX compound identifier | DTXCID3085263 |
| P3117 | DSSTox substance ID | DTXSID40162772 |
| P646 | Freebase ID | /m/0h55h_b |
| P595 | Guide to Pharmacology Ligand ID | 247 |
| P2057 | Human Metabolome Database ID | HMDB0252924 |
| P234 | InChI | InChI=1S/C19H27N3O4S/c1-21-13-17(16-5-3-4-6-18(16)21)19(23)26-14-15-7-10-22(11-8-15)12-9-20-27(2,24)25/h3-6,13,15,20H,7-12,14H2,1-2H3 |
| P235 | InChIKey | MOZPSIXKYJUTKI-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C082871 |
| P6366 | Microsoft Academic ID (discontinued) | 2777850815 |
| P11199 | Probes And Drugs ID | PD015324 |
| P662 | PubChem CID | 119376 |
| P1579 | Reaxys registry number | 7778599 |
| P2877 | SureChEMBL ID | 1502039 |
| P2877 | SureChEMBL ID | 29397805 |
| P11089 | UniChem compound ID | 561560 |
| P652 | UNII | ZT350OYT3I |
Why not click here or view trends?
log id: None