Wikidata entity: Q5514393
C₁₉H₂₅Cl₂N₃O₃ (P274)
Quantities
| P2067 | mass | 413.127297 |
| P233 | canonical SMILES | String | COC(=O)N1CCN(C(C1)CN2CCCC2)C(=O)CC3=CC(=C(C=C3)Cl)Cl | ??? |
| P373 | Commons category | String | GR-89696 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q8083989 (opioid receptor kappa 1) | opioid receptor kappa 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 126766-32-3 |
| P683 | ChEBI ID | 91965 |
| P592 | ChEMBL ID | CHEMBL603370 |
| P661 | ChemSpider ID | 3385 |
| P8494 | DSSTOX compound identifier | DTXCID601013286 |
| P3117 | DSSTox substance ID | DTXSID50875164 |
| P646 | Freebase ID | /m/0ch1_m6 |
| P595 | Guide to Pharmacology Ligand ID | 1649 |
| P2057 | Human Metabolome Database ID | HMDB0252928 |
| P234 | InChI | InChI=1S/C19H25Cl2N3O3/c1-27-19(26)23-8-9-24(15(13-23)12-22-6-2-3-7-22)18(25)11-14-4-5-16(20)17(21)10-14/h4-5,10,15H,2-3,6-9,11-13H2,1H3 |
| P235 | InChIKey | HJUAKZYKCANOOZ-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2779906743 |
| P3636 | PDB ligand ID | U9I |
| P638 | PDB structure ID | 8DZR |
| P638 | PDB structure ID | 8DZS |
| P11199 | Probes And Drugs ID | PD051847 |
| P662 | PubChem CID | 3505 |
| P2877 | SureChEMBL ID | 4545382 |
| P2877 | SureChEMBL ID | 29878663 |
| P11089 | UniChem compound ID | 784356 |
| P652 | UNII | YXV3Q43RS9 |
Why not click here or view trends?
log id: 4364149