Wikidata entity: Q5613557
C₁₀H₁₉N₃O₂ (P274)
Quantities
| P2067 | mass | 213.147727 |
| P233 | canonical SMILES | String | C1CCC2(CC1)OCC(O2)CN=C(N)N | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q41861 (arterial hypertension) | arterial hypertension |
| P5555 | schematic | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Guanadrel%20synthesis.png | ??? |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q575890 (antihypertensive drug) | antihypertensive drug |
| P2868 | subject has role | ... | Q4734924 (alpha-adrenergic agonist) | alpha-adrenergic agonist |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | guanadrel | ??? |
| P231 | CAS Registry Number | 40580-59-4 |
| P683 | ChEBI ID | 5555 |
| P592 | ChEMBL ID | CHEMBL1037 |
| P661 | ChemSpider ID | 35305 |
| P661 | ChemSpider ID | 21240719 |
| P715 | DrugBank ID | DB00226 |
| P11198 | DrugCentral ID | 1339 |
| P8494 | DSSTOX compound identifier | DTXCID8028000 |
| P3117 | DSSTox substance ID | DTXSID2048533 |
| P646 | Freebase ID | /m/05213zq |
| P595 | Guide to Pharmacology Ligand ID | 7193 |
| P2057 | Human Metabolome Database ID | HMDB0014371 |
| P234 | InChI | InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
| P235 | InChIKey | HPBNRIOWIXYZFK-UHFFFAOYSA-N |
| P665 | KEGG ID | C07035 |
| P665 | KEGG ID | D08029 |
| P486 | MeSH descriptor ID | C004945 |
| P6366 | Microsoft Academic ID (discontinued) | 2776176906 |
| P2115 | NDF-RT ID | N0000147860 |
| P11199 | Probes And Drugs ID | PD010159 |
| P662 | PubChem CID | 38521 |
| P1579 | Reaxys registry number | 8325419 |
| P3345 | RxNorm CUI | 26296 |
| P2877 | SureChEMBL ID | 180963 |
| P2892 | UMLS CUI | C0061938 |
| P2892 | UMLS CUI | C0720982 |
| P11089 | UniChem compound ID | 428208 |
| P652 | UNII | 765C9332T4 |
Why not click here or view trends?
log id: 1029762