C₁₀H₁₂N₂O₄ (P274)
Quantities
| P2067 | mass | 224.079706864 |
| P233 | canonical SMILES | String | C1=CC(=C(C(=C1)O)N)C(=O)CC(C(=O)O)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=CC(=C(C(=C1)O)N)C(=O)C[C@H](C(=O)O)N | ??? |
| P3364 | stereoisomer of | ... | Q27102345 (3-hydroxy-L-kynurenine) | 3-hydroxy-L-kynurenine |
| P3364 | stereoisomer of | ... | Q106345536 (3-hydroxy-L-kynurenine zwitterion) | 3-hydroxy-L-kynurenine zwitterion |
| P279 | subclass of | ... | Q2815992 (3-hydroxy-DL-kynurenine) | 3-hydroxy-DL-kynurenine |
| P231 | CAS Registry Number | 4043-91-8 |
| P683 | ChEBI ID | 141610 |
| P592 | ChEMBL ID | CHEMBL1371152 |
| P661 | ChemSpider ID | 5036599 |
| P8494 | DSSTOX compound identifier | DTXCID10375812 |
| P3117 | DSSTox substance ID | DTXSID90424978 |
| P234 | InChI | InChI=1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)/t6-/m1/s1 |
| P235 | InChIKey | VCKPUUFAIGNJHC-ZCFIWIBFSA-N |
| P2085 | Nikkaji ID | J253.897K |
| P662 | PubChem CID | 6604307 |
| P662 | PubChem CID | 51377238 |
| P2877 | SureChEMBL ID | 17641540 |
| P2877 | SureChEMBL ID | 29934345 |
| P11089 | UniChem compound ID | 785522 |
| P652 | UNII | QKM9FLW7MU |
Why not click here or view trends?
log id: 3658209