Wikidata entity: Q599052
C₁₇H₁₉NO (P274)
Quantities
| P2067 | mass | 253.147 |
| P233 | canonical SMILES | String | CN1CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3 | ??? |
| P373 | Commons category | String | Nefopam | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P769 | significant drug interaction | ... | Q58396 (imipramine) | imipramine |
| P769 | significant drug interaction | ... | Q58397 (amitriptyline) | amitriptyline |
| P769 | significant drug interaction | ... | Q58713 (clomipramine) | clomipramine |
| P769 | significant drug interaction | ... | Q71704041 ((E/Z)-doxepin) | (E/Z)-doxepin |
| P769 | significant drug interaction | ... | Q423498 (trimipramine) | trimipramine |
| P279 | subclass of | ... | Q57842052 (substituted benzene) | substituted benzene |
| P279 | subclass of | ... | Q71573538 (oxacycle) | oxacycle |
| P279 | subclass of | ... | Q2758348 (nitrogen heterocycle) | nitrogen heterocycle |
| P2868 | subject has role | ... | Q1747785 (non-opioid analgesic) | non-opioid analgesic |
| P267 | ATC code | N02BG06 |
| P231 | CAS Registry Number | 13669-70-0 |
| P683 | ChEBI ID | 88318 |
| P592 | ChEMBL ID | CHEMBL465026 |
| P661 | ChemSpider ID | 4295 |
| P715 | DrugBank ID | DB12293 |
| P11198 | DrugCentral ID | 1891 |
| P8494 | DSSTOX compound identifier | DTXCID8028002 |
| P3117 | DSSTox substance ID | DTXSID2048535 |
| P232 | EC number | 237-148-2 |
| P2566 | ECHA Substance Infocard ID | 100.033.757 |
| P646 | Freebase ID | /m/03nqd6_ |
| P2057 | Human Metabolome Database ID | HMDB0255504 |
| P234 | InChI | InChI=1S/C17H19NO/c1-18-11-12-19-17(14-7-3-2-4-8-14)16-10-6-5-9-15(16)13-18/h2-10,17H,11-13H2,1H3 |
| P235 | InChIKey | RGPDEAGGEXEMMM-UHFFFAOYSA-N |
| P7783 | J-GLOBAL ID | 200907043573635303 |
| P665 | KEGG ID | D08258 |
| P486 | MeSH descriptor ID | D009340 |
| P672 | MeSH tree code | D03.383.113.767.500 |
| P6366 | Microsoft Academic ID (discontinued) | 2781083246 |
| P2085 | Nikkaji ID | J8.442E |
| P4235 | PatientsLikeMe treatment ID | nefopam |
| P11199 | Probes And Drugs ID | PD001877 |
| P662 | PubChem CID | 4450 |
| P3345 | RxNorm CUI | 7285 |
| P2877 | SureChEMBL ID | 23646 |
| P11089 | UniChem compound ID | 56656 |
| P652 | UNII | 4UP8060B7J |
Why not click here or view trends?
log id: 1878208