Wikidata entity: Q599160
C₂₀H₂₂N₂ (P274)
Quantities
| P4250 | defined daily dose | 2 |
| P2067 | mass | 290.178299 |
| P233 | canonical SMILES | String | CN1CCC(=C2C3=CC=CC=C3CCC4=C2N=CC=C4)CC1 | ??? |
| P373 | Commons category | String | Azatadine | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q187440 (urticaria) | urticaria |
| P3489 | pregnancy category | ... | Q28123616 (US pregnancy category B) | US pregnancy category B |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q1328275 (H1 antagonist) | H1 antagonist |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | azatadine | ??? |
| P267 | ATC code | R06AX09 |
| P231 | CAS Registry Number | 3964-81-6 |
| P683 | ChEBI ID | 2946 |
| P592 | ChEMBL ID | CHEMBL946 |
| P661 | ChemSpider ID | 18709 |
| P715 | DrugBank ID | DB00719 |
| P11198 | DrugCentral ID | 268 |
| P8494 | DSSTOX compound identifier | DTXCID702636 |
| P3117 | DSSTox substance ID | DTXSID6022636 |
| P646 | Freebase ID | /m/0fmnyv |
| P595 | Guide to Pharmacology Ligand ID | 7119 |
| P2057 | Human Metabolome Database ID | HMDB0014857 |
| P234 | InChI | InChI=1S/C20H22N2/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19/h2-7,12H,8-11,13-14H2,1H3 |
| P235 | InChIKey | SEBMTIQKRHYNIT-UHFFFAOYSA-N |
| P665 | KEGG ID | C07774 |
| P665 | KEGG ID | D07482 |
| P486 | MeSH descriptor ID | C006656 |
| P6366 | Microsoft Academic ID (discontinued) | 2778927629 |
| P2115 | NDF-RT ID | N0000147714 |
| P11199 | Probes And Drugs ID | PD010061 |
| P662 | PubChem CID | 19861 |
| P1579 | Reaxys registry number | 889600 |
| P3345 | RxNorm CUI | 18600 |
| P2877 | SureChEMBL ID | 3721 |
| P2892 | UMLS CUI | C0052759 |
| P11089 | UniChem compound ID | 65792 |
| P652 | UNII | 94Z39NID6C |
Why not click here or view trends?
log id: 3559461