Wikidata entity: Q6065448
C₁₉H₂₃N₅O₃S (P274)
Quantities
| P2067 | mass | 401.152 |
| P233 | canonical SMILES | String | C1CN(CCN1CCCCN2C(=O)C3=CC=CC=C3S2(=O)=O)C4=NC=CC=N4 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21115043 (5-hydroxytryptamine receptor 1A) | 5-hydroxytryptamine receptor 1A |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q62903 (anxiolytic) | anxiolytic |
| P2868 | subject has role | ... | Q7455050 (serotonin receptor agonists) | serotonin receptor agonists |
| P231 | CAS Registry Number | 95847-70-4 |
| P683 | ChEBI ID | 93578 |
| P592 | ChEMBL ID | CHEMBL8412 |
| P661 | ChemSpider ID | 51365 |
| P8494 | DSSTOX compound identifier | DTXCID2025688 |
| P3117 | DSSTox substance ID | DTXSID4045688 |
| P646 | Freebase ID | /m/0g3r_z |
| P595 | Guide to Pharmacology Ligand ID | 42 |
| P2057 | Human Metabolome Database ID | HMDB0253573 |
| P234 | InChI | InChI=1S/C19H23N5O3S/c25-18-16-6-1-2-7-17(16)28(26,27)24(18)11-4-3-10-22-12-14-23(15-13-22)19-20-8-5-9-21-19/h1-2,5-9H,3-4,10-15H2 |
| P235 | InChIKey | TZJUVVIWVWFLCD-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C043077 |
| P6366 | Microsoft Academic ID (discontinued) | 2778362415 |
| P10283 | OpenAlex ID | C2778362415 |
| P11199 | Probes And Drugs ID | PD013102 |
| P662 | PubChem CID | 56971 |
| P2877 | SureChEMBL ID | 79574 |
| P11089 | UniChem compound ID | 188808 |
| P652 | UNII | 6J9B11MN0K |
Why not click here or view trends?
log id: 2027610