Wikidata entity: Q63088173
C₆H₁₀N₆O (P274)
Quantities
| P2067 | mass | 182.09160894 |
| P233 | canonical SMILES | String | CN(C)N=NC1=C(NC=N1)C(=O)N | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P279 | subclass of | ... | Q1659847 (imidazole) | imidazole |
| P231 | CAS Registry Number | 4342-03-4 |
| P683 | ChEBI ID | 4305 |
| P8494 | DSSTOX compound identifier | DTXCID20369 |
| P3117 | DSSTox substance ID | DTXSID0020369 |
| P2057 | Human Metabolome Database ID | HMDB0014989 |
| P234 | InChI | InChI=1S/C6H10N6O/c1-12(2)11-10-6-4(5(7)13)8-3-9-6/h3H,1-2H3,(H2,7,13)(H,8,9) |
| P235 | InChIKey | FDKXTQMXEQVLRF-UHFFFAOYSA-N |
| P2840 | NSC number | 45388 |
| P2840 | NSC number | 759610 |
| P11199 | Probes And Drugs ID | PD009688 |
| P662 | PubChem CID | 2942 |
| P2877 | SureChEMBL ID | 6372 |
| P2877 | SureChEMBL ID | 25209820 |
| P11089 | UniChem compound ID | 924117 |
Why not click here or view trends?
log id: 4624474