Wikidata entity: Q6456100
C₉H₁₃NO (P274)
Quantities
| P2067 | mass | 151.1 |
| P233 | canonical SMILES | String | CC(C(C1=CC=CC=C1)O)N | ??? |
| P703 | found in taxon | ... | Q207642 (Catha edulis) | Catha edulis |
| P703 | found in taxon | ... | Q2602813 (Ephedra sinica) | Ephedra sinica |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H]([C@@H](C1=CC=CC=C1)O)N | ??? |
| P3364 | stereoisomer of | ... | Q413147 ((+)-norephedrin) | (+)-norephedrin |
| P3364 | stereoisomer of | ... | Q423797 ((+)-norpseudoephedrine) | (+)-norpseudoephedrine |
| P3364 | stereoisomer of | ... | Q26840801 ((-)-norephedrine) | (-)-norephedrine |
| P279 | subclass of | ... | Q59628358 ((±)-norpseudoephedrin) | (±)-norpseudoephedrin |
| P279 | subclass of | ... | Q109195877 (1-phenylpropan-2-amine alkaloid) | 1-phenylpropan-2-amine alkaloid |
| P231 | CAS Registry Number | 37577-07-4 |
| P683 | ChEBI ID | 8104 |
| P592 | ChEMBL ID | CHEMBL1788114 |
| P661 | ChemSpider ID | 142493 |
| P8494 | DSSTOX compound identifier | DTXCID501028660 |
| P3117 | DSSTox substance ID | DTXSID001045718 |
| P3117 | DSSTox substance ID | DTXSID20889399 |
| P232 | EC number | 636-436-9 |
| P2566 | ECHA Substance Infocard ID | 100.164.234 |
| P646 | Freebase ID | /m/0jwzhbz |
| P4168 | IEDB Epitope ID | 768756 |
| P234 | InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m1/s1 |
| P235 | InChIKey | DLNKOYKMWOXYQA-APPZFPTMSA-N |
| P665 | KEGG ID | C07911 |
| P665 | KEGG ID | D08368 |
| P3636 | PDB ligand ID | NPU |
| P638 | PDB structure ID | 3U8Q |
| P11199 | Probes And Drugs ID | PD017909 |
| P662 | PubChem CID | 162265 |
| P2877 | SureChEMBL ID | 125333 |
| P11089 | UniChem compound ID | 1066548 |
| P652 | UNII | QQ0FVC4PXS |
Why not click here or view trends?
log id: 6186591