Wikidata entity: Q6460422
C₂₁H₂₂FN₃O (P274)
Quantities
| P2067 | mass | 351.174691 |
| P233 | canonical SMILES | String | CN1CCC(CC1)C2=CNC3=C2C=C(C=C3)NC(=O)C4=CC=C(C=C4)F | ??? |
| P373 | Commons category | String | LY-334370 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21115052 (5-hydroxytryptamine receptor 1F) | 5-hydroxytryptamine receptor 1F |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 182563-08-2 |
| P592 | ChEMBL ID | CHEMBL101690 |
| P661 | ChemSpider ID | 4470773 |
| P8494 | DSSTOX compound identifier | DTXCID30366368 |
| P3117 | DSSTox substance ID | DTXSID40415518 |
| P646 | Freebase ID | /m/03w9q8f |
| P595 | Guide to Pharmacology Ligand ID | 20 |
| P595 | Guide to Pharmacology Ligand ID | 151 |
| P2057 | Human Metabolome Database ID | HMDB0254254 |
| P234 | InChI | InChI=1S/C21H22FN3O/c1-25-10-8-14(9-11-25)19-13-23-20-7-6-17(12-18(19)20)24-21(26)15-2-4-16(22)5-3-15/h2-7,12-14,23H,8-11H2,1H3,(H,24,26) |
| P235 | InChIKey | MDMJLMDBRQXOOI-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2776804942 |
| P11199 | Probes And Drugs ID | PD046573 |
| P662 | PubChem CID | 5311258 |
| P2877 | SureChEMBL ID | 6911508 |
| P11089 | UniChem compound ID | 320459 |
| P652 | UNII | 5Q7I1WL2UY |
Why not click here or view trends?
log id: 3016313