Wikidata entity: Q6505756
C₈H₁₀ClN₃O (P274)
Quantities
| P2067 | mass | 199.051 |
| P233 | canonical SMILES | String | C1=CC(=NC=C1Cl)C(=O)NCCN | ??? |
| P373 | Commons category | String | Lazabemide | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21109462 (Monoamine oxidase B) | Monoamine oxidase B |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q3579672 (antiparkinson) | antiparkinson |
| P2868 | subject has role | ... | Q410954 (monoamine oxidase inhibitor) | monoamine oxidase inhibitor |
| P231 | CAS Registry Number | 103878-84-8 |
| P592 | ChEMBL ID | CHEMBL279390 |
| P661 | ChemSpider ID | 64426 |
| P8494 | DSSTOX compound identifier | DTXCID3028269 |
| P3117 | DSSTox substance ID | DTXSID2048294 |
| P646 | Freebase ID | /m/043jm8y |
| P595 | Guide to Pharmacology Ligand ID | 6640 |
| P234 | InChI | InChI=1S/C8H10ClN3O/c9-6-1-2-7(12-5-6)8(13)11-4-3-10/h1-2,5H,3-4,10H2,(H,11,13) |
| P235 | InChIKey | JZXRLKWWVNUZRB-UHFFFAOYSA-N |
| P665 | KEGG ID | D04681 |
| P486 | MeSH descriptor ID | C059303 |
| P6366 | Microsoft Academic ID (discontinued) | 2779416082 |
| P11199 | Probes And Drugs ID | PD012645 |
| P662 | PubChem CID | 71307 |
| P2877 | SureChEMBL ID | 121998 |
| P11089 | UniChem compound ID | 265402 |
| P652 | UNII | 420HD787N9 |
Why not click here or view trends?
log id: 2086248