Wikidata entity: Q6590371
C₁₅H₂₁N₅O₄ (P274)
Quantities
| P2067 | mass | 335.159 |
| P233 | canonical SMILES | String | C1CCC(C1)NC2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O | ??? |
| P373 | Commons category | String | N6-Cyclopentyladenosine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1CCC(C1)NC2=NC=NC3=C2N=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O | ??? |
| P129 | physically interacts with | ... | Q3062781 (Adenosine A1 receptor) | Adenosine A1 receptor |
| P129 | physically interacts with | ... | Q21116154 (Adenosine A3 receptor) | Adenosine A3 receptor |
| P129 | physically interacts with | ... | Q21116162 (Adenosine A2a receptor) | Adenosine A2a receptor |
| P129 | physically interacts with | ... | Q21116164 (Adenosine A2b receptor) | Adenosine A2b receptor |
| P279 | subclass of | ... | Q27163726 (2-[6-(cyclopentylamino)-9-purinyl]-5-(hydroxymethyl)oxolane-3,4-diol) | 2-[6-(cyclopentylamino)-9-purinyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| P2868 | subject has role | ... | Q50430408 (purinergic P1 receptor agonist) | purinergic P1 receptor agonist |
| P231 | CAS Registry Number | 41552-82-3 |
| P592 | ChEMBL ID | CHEMBL68738 |
| P661 | ChemSpider ID | 571479 |
| P8494 | DSSTOX compound identifier | DTXCID701389624 |
| P3117 | DSSTox substance ID | DTXSID80961807 |
| P646 | Freebase ID | /m/06zr0f7 |
| P595 | Guide to Pharmacology Ligand ID | 380 |
| P234 | InChI | InChI=1S/C15H21N5O4/c21-5-9-11(22)12(23)15(24-9)20-7-18-10-13(16-6-17-14(10)20)19-8-3-1-2-4-8/h6-9,11-12,15,21-23H,1-5H2,(H,16,17,19)/t9-,11-,12-,15-/m1/s1 |
| P235 | InChIKey | SQMWSBKSHWARHU-SDBHATRESA-N |
| P486 | MeSH descriptor ID | C048599 |
| P6366 | Microsoft Academic ID (discontinued) | 2780677799 |
| P3636 | PDB ligand ID | 3GU |
| P638 | PDB structure ID | 3GU8 |
| P11199 | Probes And Drugs ID | PD021807 |
| P662 | PubChem CID | 657378 |
| P2877 | SureChEMBL ID | 120481 |
| P2892 | UMLS CUI | C0067224 |
| P11089 | UniChem compound ID | 433002 |
| P652 | UNII | 7LG47VG1ID |
Why not click here or view trends?
log id: 5850232