Wikidata entity: Q6605919
C₂₃H₂₈N₈OS (P274)
Quantities
| P2067 | mass | 464.211 |
| P233 | canonical SMILES | String | CC1=CC(=NN1)NC2=NC(=NC(=C2)N3CCN(CC3)C)SC4=CC=C(C=C4)NC(=O)C5CC5 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q4822488 (Aurora kinase A) | Aurora kinase A |
| P129 | physically interacts with | ... | Q4822491 (Aurora kinase B) | Aurora kinase B |
| P129 | physically interacts with | ... | Q21132140 (Aurora kinase C) | Aurora kinase C |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 639089-54-6 |
| P683 | ChEBI ID | 91336 |
| P592 | ChEMBL ID | CHEMBL572878 |
| P661 | ChemSpider ID | 4591897 |
| P8494 | DSSTOX compound identifier | DTXCID90136100 |
| P3117 | DSSTox substance ID | DTXSID10213609 |
| P646 | Freebase ID | /m/0h3r2gn |
| P595 | Guide to Pharmacology Ligand ID | 5718 |
| P234 | InChI | InChI=1S/C23H28N8OS/c1-15-13-20(29-28-15)25-19-14-21(31-11-9-30(2)10-12-31)27-23(26-19)33-18-7-5-17(6-8-18)24-22(32)16-3-4-16/h5-8,13-14,16H,3-4,9-12H2,1-2H3,(H,24,32)(H2,25,26,27,28,29) |
| P235 | InChIKey | GCIKSSRWRFVXBI-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2777329713 |
| P3636 | PDB ligand ID | VX6 |
| P638 | PDB structure ID | 2F4J |
| P638 | PDB structure ID | 4JBQ |
| P638 | PDB structure ID | 3AMB |
| P638 | PDB structure ID | 4ZOG |
| P638 | PDB structure ID | 3E5A |
| P638 | PDB structure ID | 4B8M |
| P638 | PDB structure ID | 4AF3 |
| P638 | PDB structure ID | 2XYN |
| P11199 | Probes And Drugs ID | PD003407 |
| P662 | PubChem CID | 5494449 |
| P2877 | SureChEMBL ID | 614528 |
| P2877 | SureChEMBL ID | 2682989 |
| P11089 | UniChem compound ID | 42301 |
| P652 | UNII | 234335M86K |
Why not click here or view trends?
log id: 4138858