Wikidata entity: Q676896
C₁₂H₁₈N₂O (P274)
Quantities
| P2067 | mass | 206.142 |
| P233 | canonical SMILES | String | C1CCN(C1)CC#CCN2CCCC2=O | ??? |
| P373 | Commons category | String | Oxotremorine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q2844056 (Cholinergic receptor muscarinic 3) | Cholinergic receptor muscarinic 3 |
| P129 | physically interacts with | ... | Q4847900 (Cholinergic receptor muscarinic 1) | Cholinergic receptor muscarinic 1 |
| P129 | physically interacts with | ... | Q4847907 (Cholinergic receptor muscarinic 4) | Cholinergic receptor muscarinic 4 |
| P129 | physically interacts with | ... | Q4847910 (Cholinergic receptor muscarinic 2) | Cholinergic receptor muscarinic 2 |
| P279 | subclass of | ... | Q121544406 (acetylenic compound) | acetylenic compound |
| P2868 | subject has role | ... | Q6940221 (muscarinic agonist) | muscarinic agonist |
| P231 | CAS Registry Number | 70-22-4 |
| P683 | ChEBI ID | 7851 |
| P592 | ChEMBL ID | CHEMBL7634 |
| P661 | ChemSpider ID | 4469 |
| P8494 | DSSTOX compound identifier | DTXCID10142743 |
| P3117 | DSSTox substance ID | DTXSID10220252 |
| P232 | EC number | 200-728-0 |
| P2566 | ECHA Substance Infocard ID | 100.000.662 |
| P646 | Freebase ID | /m/03cpntn |
| P595 | Guide to Pharmacology Ligand ID | 302 |
| P2057 | Human Metabolome Database ID | HMDB0256004 |
| P234 | InChI | InChI=1S/C12H18N2O/c15-12-6-5-11-14(12)10-4-3-9-13-7-1-2-8-13/h1-2,5-11H2 |
| P235 | InChIKey | RSDOPYMFZBJHRL-UHFFFAOYSA-N |
| P665 | KEGG ID | C07485 |
| P486 | MeSH descriptor ID | D010095 |
| P672 | MeSH tree code | D03.383.773.812.498 |
| P6366 | Microsoft Academic ID (discontinued) | 2778824757 |
| P2840 | NSC number | 330497 |
| P10283 | OpenAlex ID | C2778824757 |
| P11199 | Probes And Drugs ID | PD048315 |
| P662 | PubChem CID | 4630 |
| P4964 | SPLASH | splash10-059o-6900000001-f8afd676b47b6d8bcfb6 |
| P2877 | SureChEMBL ID | 2128 |
| P2892 | UMLS CUI | C0030038 |
| P11089 | UniChem compound ID | 164090 |
| P652 | UNII | 5RY0UWH1JL |
Why not click here or view trends?
log id: 3469858