Wikidata entity: Q7181340
C₁₁H₁₄N₂O₂ (P274)
Quantities
| P2067 | mass | 206.106 |
| P233 | canonical SMILES | String | CCC(C1=CC=CC=C1)C(=O)NC(=O)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q41571 (epilepsy) | epilepsy |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q576618 (anticonvulsant agent) | anticonvulsant agent |
| P267 | ATC code | N03AX13 |
| P231 | CAS Registry Number | 90-49-3 |
| P683 | ChEBI ID | 31989 |
| P592 | ChEMBL ID | CHEMBL2107062 |
| P661 | ChemSpider ID | 65046 |
| P661 | ChemSpider ID | 21235365 |
| P715 | DrugBank ID | DB13362 |
| P11198 | DrugCentral ID | 2125 |
| P8494 | DSSTOX compound identifier | DTXCID40612 |
| P3117 | DSSTox substance ID | DTXSID4020612 |
| P232 | EC number | 201-998-2 |
| P2566 | ECHA Substance Infocard ID | 100.001.817 |
| P646 | Freebase ID | /m/0gb2rv |
| P2057 | Human Metabolome Database ID | HMDB0256403 |
| P234 | InChI | InChI=1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15) |
| P235 | InChIKey | AJOQSQHYDOFIOX-UHFFFAOYSA-N |
| P665 | KEGG ID | C12590 |
| P665 | KEGG ID | D01190 |
| P486 | MeSH descriptor ID | C005825 |
| P6366 | Microsoft Academic ID (discontinued) | 2781224874 |
| P11199 | Probes And Drugs ID | PD014199 |
| P662 | PubChem CID | 72060 |
| P2877 | SureChEMBL ID | 35066 |
| P11089 | UniChem compound ID | 1067880 |
| P652 | UNII | 878CEJ4HGX |
Why not click here or view trends?
log id: 2249947