Wikidata entity: Q7187582
C₅H₁₄NO₄P (P274)
Quantities
| P2067 | mass | 183.066 |
| P233 | canonical SMILES | String | C[N+](C)(C)CCOP(=O)(O)[O-] | ??? |
| P4147 | conjugate acid | ... | Q576895 (phosphocholine cation) | phosphocholine cation |
| P4149 | conjugate base | ... | Q27225724 (choline phosphate(1-)) | choline phosphate(1-) |
| P703 | found in taxon | ... | Q15978631 (Homo sapiens) | Homo sapiens |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q326277 (cation) | cation |
| P231 | CAS Registry Number | 645-84-1 |
| P592 | ChEMBL ID | CHEMBL3350840 |
| P661 | ChemSpider ID | 119298 |
| P9272 | DeCS ID | 10963 |
| P11198 | DrugCentral ID | 2155 |
| P8494 | DSSTOX compound identifier | DTXCID701410312 |
| P3117 | DSSTox substance ID | DTXSID80983064 |
| P646 | Freebase ID | /m/0fcn78 |
| P234 | InChI | InChI=1S/C5H14NO4P/c1-6(2,3)4-5-10-11(7,8)9/h4-5H2,1-3H3,(H-,7,8,9) |
| P235 | InChIKey | YHHSONZFOIEMCP-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | D010767 |
| P672 | MeSH tree code | D02.092.877.883.333.700 |
| P672 | MeSH tree code | D02.675.276.232.700 |
| P6366 | Microsoft Academic ID (discontinued) | 2776833585 |
| P10283 | OpenAlex ID | C2776833585 |
| P11199 | Probes And Drugs ID | PD073516 |
| P662 | PubChem CID | 135437 |
| P4964 | SPLASH | splash10-001i-3900000000-319877dff386b243c199 |
| P2877 | SureChEMBL ID | 8011 |
| P2892 | UMLS CUI | C0031716 |
| P11089 | UniChem compound ID | 27306087 |
| P652 | UNII | BRP7TI555O |
Why not click here or view trends?
log id: 5190493