Wikidata entity: Q72440822
C₉H₁₁NO₂ (P274)
Quantities
| P2067 | mass | 165.078978592 |
| P233 | canonical SMILES | String | NC(Cc1ccccc1)C(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | N[C@@H](Cc1ccccc1)C(=O)O | ??? |
| P3364 | stereoisomer of | ... | Q170545 (phenylalanine) | phenylalanine |
| P3364 | stereoisomer of | ... | Q26841253 (D-phenylalanine) | D-phenylalanine |
| P3364 | stereoisomer of | ... | Q106345467 (L-phenylalanine zwitterion) | L-phenylalanine zwitterion |
| P279 | subclass of | ... | Q109195877 (1-phenylpropan-2-amine alkaloid) | 1-phenylpropan-2-amine alkaloid |
| P231 | CAS Registry Number | 67675-33-6 |
| P683 | ChEBI ID | 17295 |
| P683 | ChEBI ID | 58095 |
| P715 | DrugBank ID | DB00120 |
| P3117 | DSSTox substance ID | DTXSID4040763 |
| P2057 | Human Metabolome Database ID | HMDB0000159 |
| P234 | InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
| P235 | InChIKey | COLNVLDHVKWLRT-QMMMGPOBSA-N |
| P662 | PubChem CID | 6140 |
| P662 | PubChem CID | 6925665 |
| P2877 | SureChEMBL ID | 8119 |
| P652 | UNII | 47E5O17Y3R |
Why not click here or view trends?
log id: 4192556