Wikidata entity: Q72481021
C₁₆H₁₀O₅ (P274)
Quantities
| P2067 | mass | 282.05282342 |
| P233 | canonical SMILES | String | O=C1C=C(OC=2C=C3OCOC3=C(O)C12)C=4C=CC=CC4 | ??? |
| P703 | found in taxon | ... | Q81464 (Spinacia oleracea) | Spinacia oleracea |
| P703 | found in taxon | ... | Q165191 (Beta vulgaris) | Beta vulgaris |
| P703 | found in taxon | ... | Q1569312 (Phytolacca acinosa) | Phytolacca acinosa |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q424525 (flavone) | flavone |
| P231 | CAS Registry Number | 110204-45-0 |
| P683 | ChEBI ID | 174680 |
| P3117 | DSSTox substance ID | DTXSID901187957 |
| P2057 | Human Metabolome Database ID | HMDB0034445 |
| P234 | InChI | InChI=1S/C16H10O5/c17-10-6-11(9-4-2-1-3-5-9)21-12-7-13-16(20-8-19-13)15(18)14(10)12/h1-7,18H,8H2 |
| P235 | InChIKey | NJIUXIXNVAHRDW-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00054291 |
| P662 | PubChem CID | 927642 |
| P2877 | SureChEMBL ID | 971282 |
| P11089 | UniChem compound ID | 145412 |
| P652 | UNII | 9JL54RT3QZ |
Why not click here or view trends?
log id: 5242777