| P233 | canonical SMILES | CC1=CNC=C1C(=O)C |
| P231 | CAS Registry Number | 18818-30-9 |
| P683 | ChEBI ID | 202044 |
| P8494 | DSSTOX compound identifier | DTXCID70302447 |
| P3117 | DSSTox substance ID | DTXSID40351381 |
| P232 | EC number | 808-645-7 |
| P2566 | ECHA Substance Infocard ID | 100.236.584 |
| P234 | InChI | InChI=1S/C7H9NO/c1-5-3-8-4-7(5)6(2)9/h3-4,8H,1-2H3 |
| P235 | InChIKey | CBTWAEGIWMBHTC-UHFFFAOYSA-N |
| P7746 | Natural Product Atlas ID | NPA004787 |
| P662 | PubChem CID | 698832 |
| P2877 | SureChEMBL ID | SCHEMBL2494049 |
| P11089 | UniChem compound ID | 3954775 |
| P703 | found in taxon | Penicillium citreonigrum | Q10622901 |
| P2067 | mass | 123.068413908 |
| Q103817353 | The structure and biogenesis of desoxyverrucarin E, a metabolite of Eupenicillium hirayamae | main subject | P921 |
Search more.