| type of chemical entity | Q113145171 |
| illudalane sesquiterpenoid | Q108293958 |
| P233 | canonical SMILES | CC1=C(C(=C(C2=C1C(=O)C(C2)(C)C)O)C)CCO |
| P231 | CAS Registry Number | 53823-02-2 |
| P683 | ChEBI ID | 196151 |
| P8494 | DSSTOX compound identifier | DTXCID80124596 |
| P3117 | DSSTox substance ID | DTXSID20202105 |
| P234 | InChI | InChI=1S/C15H20O3/c1-8-10(5-6-16)9(2)13(17)11-7-15(3,4)14(18)12(8)11/h16-17H,5-7H2,1-4H3 |
| P235 | InChIKey | IWRJCMQFEMXOML-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00021490 |
| P662 | PubChem CID | 3085044 |
| P11089 | UniChem compound ID | 445225 |
| P703 | found in taxon | Equisetum arvense | Q107592 |
| Phomopsis | Q374386 | ||
| Dicksonia sellowiana | Q3021768 | ||
| Onychium siliculosum | Q15234502 | ||
| Dicksonia gigantea | Q50840109 | ||
| Dicksonia karsteniana | Q95495094 | ||
| P2067 | mass | 248.1412445 |
| Q104936882 | Chemical and chemotaxonomical studies on filices. LI. Chemical studies on the constituents of Costa Rican ferns. 3. |
| Q104415711 | Flavanone and other constituents from Onychium siliculosum |
| Q78311346 | Protoilludane, Illudalane, and Botryane Sesquiterpenoids from the Endophytic Fungus Phomopsis sp. TJ507A |
| Q47414969 | Studies on the Taiwan folk medicine. VI. Studies on onitin |
| Q46362160 | Studies on the Taiwan folk medicine; III. A smooth muscle relaxant from Onychium siliculosum, onitin |
| Q105121825 | The flavonoids of Equisetum ramosissimum |
Search more.