Wikidata entity: Q72506815
C₁₉H₁₈ClN₃O₅S (P274)
Quantities
| P2067 | mass | 435.06556935599997 |
| P233 | canonical SMILES | String | O=C(NCC1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)c1ccc(Cl)s1 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1COCC(=O)N1C2=CC=C(C=C2)N3C[C@H](OC3=O)CNC(=O)C4=CC=C(S4)Cl | ??? |
| P3364 | stereoisomer of | ... | Q420262 (rivaroxaban) | rivaroxaban |
| P279 | subclass of | ... | Q82236594 (5-chloro-N-({2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl}methyl)thiophene-2-carboxamide) | 5-chloro-N-({2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl}methyl)thiophene-2-carboxamide |
| P231 | CAS Registry Number | 865479-71-6 |
| P8494 | DSSTOX compound identifier | DTXCID80418861 |
| P3117 | DSSTox substance ID | DTXSID20468042 |
| P234 | InChI | InChI=1S/C19H18ClN3O5S/c20-16-6-5-15(29-16)18(25)21-9-14-10-23(19(26)28-14)13-3-1-12(2-4-13)22-7-8-27-11-17(22)24/h1-6,14H,7-11H2,(H,21,25)/t14-/m1/s1 |
| P235 | InChIKey | KGFYHTZWPPHNLQ-CQSZACIVSA-N |
| P11199 | Probes And Drugs ID | PD012178 |
| P662 | PubChem CID | 11524901 |
| P2877 | SureChEMBL ID | 7721848 |
| P11089 | UniChem compound ID | 70944 |
| P652 | UNII | RJP4GEG36M |
Why not click here or view trends?
log id: 2827870