| type of chemical entity | Q113145171 |
| organic anion | Q43457632 |
| icosanoid anion | Q72181734 |
| P233 | canonical SMILES | CCCCCC(C=CC=CCC=CC=CC(O)CCCC(=O)[O-])OO |
| P683 | ChEBI ID | 137546 |
| P234 | InChI | InChI=1S/C20H32O5/c1-2-3-9-15-19(25-24)16-11-8-6-4-5-7-10-13-18(21)14-12-17-20(22)23/h5-8,10-11,13,16,18-19,21,24H,2-4,9,12,14-15,17H2,1H3,(H,22,23)/p-1/b7-5-,8-6-,13-10+,16-11+/t18-,19+/m1/s1 |
| P235 | InChIKey | WILWDBJHNLQDON-WZXFMMTGSA-M |
| P2017 | isomeric SMILES | CCCCC[C@@H](/C=C/C=C\C/C=C\C=C\[C@H](CCCC(=O)[O-])O)OO |
| P662 | PubChem CID | 129626678 |
| P8691 | SwissLipids ID | SLM:000597894 |
| P11089 | UniChem compound ID | 161384955 |
| P2067 | mass | 351.21769767190995 |
| Q42626453 | Strict Regiospecificity of Human Epithelial 15-Lipoxygenase-2 Delineates Its Transcellular Synthesis Potential | main subject | P921 |
Search more.