Wikidata entity: Q75850
C₁₅H₂₂O₂ (P274)
Quantities
| P2067 | mass | 234.161979944 |
| P233 | canonical SMILES | String | O=C(O)C(=CC1C2=C(C)CCC2C(C)CC1)C | ??? |
| P373 | Commons category | String | Valerenic acid | ??? |
| P1889 | different from | ... | Q407796 (valeric acid) | valeric acid |
| P703 | found in taxon | ... | Q157819 (Valeriana officinalis) | Valeriana officinalis |
| P703 | found in taxon | ... | Q12847314 (Valeriana wolgensis) | Valeriana wolgensis |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@@H]1CC[C@H](C2=C(CC[C@H]12)C)/C=C(\C)/C(=O)O | ??? |
| P3364 | stereoisomer of | ... | Q104667264 (valerenic acid) | valerenic acid |
| P279 | subclass of | ... | Q104993905 (valerenic acid) | valerenic acid |
| P231 | CAS Registry Number | 3569-10-6 |
| P683 | ChEBI ID | 9921 |
| P661 | ChemSpider ID | 4788689 |
| P8494 | DSSTOX compound identifier | DTXCID6014089 |
| P3117 | DSSTox substance ID | DTXSID8034089 |
| P232 | EC number | 609-163-8 |
| P2566 | ECHA Substance Infocard ID | 100.112.154 |
| P646 | Freebase ID | /m/02x0931 |
| P234 | InChI | InChI=1S/C15H22O2/c1-9-4-6-12(8-11(3)15(16)17)14-10(2)5-7-13(9)14/h8-9,12-13H,4-7H2,1-3H3,(H,16,17)/b11-8+/t9-,12+,13-/m1/s1 |
| P235 | InChIKey | FEBNTWHYQKGEIQ-SUKRRCERSA-N |
| P665 | KEGG ID | C09743 |
| P2064 | KNApSAcK ID | C00003197 |
| P2063 | LIPID MAPS ID | LMPR0103460001 |
| P6366 | Microsoft Academic ID (discontinued) | 2779841928 |
| P11199 | Probes And Drugs ID | PD070256 |
| P662 | PubChem CID | 6440940 |
| P2877 | SureChEMBL ID | 403082 |
| P11089 | UniChem compound ID | 759574 |
| P652 | UNII | 34NDB285PM |
Why not click here or view trends?
log id: 5327495