Wikidata entity: Q7705238
C₁₆H₂₅NO₂S (P274)
Quantities
| P4250 | defined daily dose | 5 |
| P2067 | mass | 295.1606 |
| P233 | canonical SMILES | String | CC(C)(C)NCC(COC1=CC=CC2=C1SCCC2)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q4897175 (adrenoceptor beta 3) | adrenoceptor beta 3 |
| P129 | physically interacts with | ... | Q21498865 (Adrenergic receptor, beta 3) | Adrenergic receptor, beta 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q241549 (antiarrhythmic agent) | antiarrhythmic agent |
| P2868 | subject has role | ... | Q816759 (beta blocker) | beta blocker |
| P267 | ATC code | C07AA16 |
| P231 | CAS Registry Number | 83688-84-0 |
| P683 | ChEBI ID | 135244 |
| P592 | ChEMBL ID | CHEMBL434200 |
| P661 | ChemSpider ID | 33875 |
| P715 | DrugBank ID | DB13775 |
| P11198 | DrugCentral ID | 2605 |
| P3117 | DSSTox substance ID | DTXSID80865735 |
| P232 | EC number | 280-519-9 |
| P2566 | ECHA Substance Infocard ID | 100.073.179 |
| P646 | Freebase ID | /m/03m5q6g |
| P595 | Guide to Pharmacology Ligand ID | 571 |
| P2057 | Human Metabolome Database ID | HMDB0042026 |
| P234 | InChI | InChI=1S/C16H25NO2S/c1-16(2,3)17-10-13(18)11-19-14-8-4-6-12-7-5-9-20-15(12)14/h4,6,8,13,17-18H,5,7,9-11H2,1-3H3 |
| P235 | InChIKey | HTWFXPCUFWKXOP-UHFFFAOYSA-N |
| P665 | KEGG ID | D07182 |
| P486 | MeSH descriptor ID | C005632 |
| P6366 | Microsoft Academic ID (discontinued) | 2777228551 |
| P11199 | Probes And Drugs ID | PD051695 |
| P662 | PubChem CID | 36920 |
| P3345 | RxNorm CUI | 37840 |
| P2877 | SureChEMBL ID | 49634 |
| P11089 | UniChem compound ID | 329670 |
| P652 | UNII | 9ZO341YQXP |
Why not click here or view trends?
log id: 3476384