| P233 | canonical SMILES | CC1=CC(=C2C(=C1OC)OCO2)OC |
| P231 | CAS Registry Number | 165816-66-0 |
| P683 | ChEBI ID | 210092 |
| P8494 | DSSTOX compound identifier | DTXCID60598014 |
| P3117 | DSSTox substance ID | DTXSID10647263 |
| P234 | InChI | InChI=1S/C10H12O4/c1-6-4-7(11-2)9-10(8(6)12-3)14-5-13-9/h4H,5H2,1-3H3 |
| P235 | InChIKey | RJXJHEYXZURDJH-UHFFFAOYSA-N |
| P7746 | Natural Product Atlas ID | NPA009708 |
| P2840 | NSC number | 752390 |
| P662 | PubChem CID | 24776443 |
| P2877 | SureChEMBL ID | SCHEMBL955644 |
| P11089 | UniChem compound ID | 547792 |
| P652 | UNII | JC5L581SKB |
| P703 | found in taxon | Taiwanofungus camphoratus | Q15636116 |
| Antrodia cinnamomea | Q10413755 | ||
| P2067 | mass | 196.073558864 |
| Q104102856 | A sesquiterpene lactone, phenyl and biphenyl compounds from Antrodia cinnamomea |
| Q34636030 | Anti-inflammatory benzenoids from Antrodia camphorata. |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
Search more.