Abstract is: Thiamine monophosphate is a thiamine derivative. It occurs naturally in milk.
P7049 | AICS Chemical ID (BEING DELETED) | 4664 |
P233 | canonical SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCOP(=O)(O)O.[Cl-] |
P231 | CAS Registry Number | 532-40-1 |
P683 | ChEBI ID | 18338 |
P592 | ChEMBL ID | CHEMBL2106811 |
P661 | ChemSpider ID | 10307 |
P715 | DrugBank ID | DB16023 |
P8494 | DSSTOX compound identifier | DTXCID4026397 |
P3117 | DSSTox substance ID | DTXSID6046397 |
P232 | EC number | 208-536-9 |
P2566 | ECHA Substance Infocard ID | 100.007.762 |
P646 | Freebase ID | /m/02qr_56 |
P1578 | Gmelin number | 1107622 |
P234 | InChI | InChI=1S/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H |
P235 | InChIKey | GUGWNSHJDUEHNJ-UHFFFAOYSA-N |
P486 | MeSH descriptor ID | D013833 |
P672 | MeSH tree code | D02.886.675.900.600 |
D03.383.129.708.900.600 | ||
D03.383.742.795.600 | ||
P6366 | Microsoft Academic ID | 2780212098 |
P11199 | Probes And Drugs ID | PD143787 |
P662 | PubChem CID | 10761 |
131664207 | ||
P1579 | Reaxys registry number | 3844977 |
P2877 | SureChEMBL ID | SCHEMBL94443 |
P2892 | UMLS CUI | C0039845 |
P11089 | UniChem compound ID | 1104138 |
P652 | UNII | P712T71Q3T |
P2067 | mass | 380.047 | |
P2868 | subject has role | vitamin B | Q183206 |
P2275 | World Health Organisation international non-proprietary name | monophosphothiamine |
Q42556464 | Application of CZE Method in Routine Analysis for Determination of B-Complex Vitamins in Pharmaceutical and Veterinary Preparations |
Q72252055 | Determination of cocarboxylase, monophosphothiamine, triphosphothiamine and thiamine by ion exchange chromatographic separation and spectrophotometric determination |
Q83187 | thiamine(1+) ion | part of | P361 |
Category:Thiamine monophosphate | wikimedia | |
azb | تیامین مونوفوسفات | wikipedia |
Thiamine monophosphate | wikipedia | |
Esperanto (eo / Q143) | Tiamina monofosfato | wikipedia |
Persian (fa / Q9168) | تیامین مونوفسفات | wikipedia |
Monophosphate de thiamine | wikipedia | |
Serbo-Croatian (sh / Q9301) | Tiamin monofosfat | wikipedia |
Tiamin monofosfat | wikipedia | |
ta | தயமின் மோனோபாசுபேட்டு | wikipedia |
Search more.