Wikidata entity: Q7862883
C₂₂H₃₂N₂O₂ (P274)
Quantities
| P2067 | mass | 356.246378 |
| P233 | canonical SMILES | String | CN(C1CCC2(CCCO2)CC1N3CCCC3)C(=O)CC4=CC=CC=C4 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)CC4=CC=CC=C4 | ??? |
| P129 | physically interacts with | ... | Q8083989 (opioid receptor kappa 1) | opioid receptor kappa 1 |
| P129 | physically interacts with | ... | Q14900999 (Opioid receptor, kappa 1) | Opioid receptor, kappa 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q173235 (analgesic) | analgesic |
| P2868 | subject has role | ... | Q122730608 (utopioid) | utopioid |
| P2868 | subject has role | ... | Q200656 (diuretic) | diuretic |
| P231 | CAS Registry Number | 96744-75-1 |
| P683 | ChEBI ID | 73357 |
| P592 | ChEMBL ID | CHEMBL440765 |
| P661 | ChemSpider ID | 94828 |
| P8494 | DSSTOX compound identifier | DTXCID1026326 |
| P3117 | DSSTox substance ID | DTXSID3046326 |
| P646 | Freebase ID | /m/0br_nbf |
| P595 | Guide to Pharmacology Ligand ID | 1655 |
| P595 | Guide to Pharmacology Ligand ID | 1656 |
| P234 | InChI | InChI=1S/C22H32N2O2/c1-23(21(25)16-18-8-3-2-4-9-18)19-10-12-22(11-7-15-26-22)17-20(19)24-13-5-6-14-24/h2-4,8-9,19-20H,5-7,10-17H2,1H3/t19-,20-,22-/m0/s1 |
| P235 | InChIKey | PGZRDDYTKFZSFR-ONTIZHBOSA-N |
| P486 | MeSH descriptor ID | C045444 |
| P6366 | Microsoft Academic ID (discontinued) | 2779364459 |
| P11199 | Probes And Drugs ID | PD039393 |
| P662 | PubChem CID | 105104 |
| P1579 | Reaxys registry number | 7488908 |
| P2877 | SureChEMBL ID | 726034 |
| P11089 | UniChem compound ID | 370597 |
| P652 | UNII | J5S4K6TKTG |
Why not click here or view trends?
log id: 2090342