Wikidata entity: Q7912593
C₃₄H₃₆F₃NO₁₃ (P274)
Quantities
| P2067 | mass | 723.213875 |
| P3780 | active ingredient in | ... | Q47522266 (Valstar) | Valstar |
| P233 | canonical SMILES | String | CCCCC(=O)OCC(=O)C1(CC(C2=C(C3=C(C(=C2C1)O)C(=O)C4=C(C3=O)C(=CC=C4)OC)O)OC5CC(C(C(O5)C)O)NC(=O)C(F)(F)F)O | ??? |
| P373 | Commons category | String | Valrubicin | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCCC(=O)OCC(=O)[C@@]1(O)C[C@H](O[C@H]2C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@H](C)O2)C3=C(C1)C(O)=C4C(=O)C5=CC=CC(OC)=C5C(=O)C4=C3O | ??? |
| P2175 | medical condition treated | ... | Q504775 (bladder cancer) | bladder cancer |
| P1748 | NCI Thesaurus ID | String | C1340 | ??? |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P279 | subclass of | ... | Q82904536 (2-Oxo-2-[2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4-({2,3,6-trideoxy-3-[(2,2,2-trifluoro-1-hydroxyethylidene)amino]hexopyranosyl}oxy)-1,2,3,4,6,11-hexahydrotetracen-2-yl]ethyl pentanoate) | 2-Oxo-2-[2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4-({2,3,6-trideoxy-3-[(2,2,2-trifluoro-1-hydroxyethylidene)amino]hexopyranosyl}oxy)-1,2,3,4,6,11-hexahydrotetracen-2-yl]ethyl pentanoate |
| P2868 | subject has role | ... | Q281044 (topoisomerase inhibitor) | topoisomerase inhibitor |
| P2868 | subject has role | ... | Q2853144 (antineoplastic) | antineoplastic |
| P2868 | subject has role | ... | Q50377178 (topoisomerase II inhibitor) | topoisomerase II inhibitor |
| P267 | ATC code | L01DB09 |
| P231 | CAS Registry Number | 56124-62-0 |
| P683 | ChEBI ID | 135876 |
| P592 | ChEMBL ID | CHEMBL20225 |
| P661 | ChemSpider ID | 38088 |
| P715 | DrugBank ID | DB00385 |
| P11198 | DrugCentral ID | 2805 |
| P8494 | DSSTOX compound identifier | DTXCID7026497 |
| P3117 | DSSTox substance ID | DTXSID9046497 |
| P232 | EC number | 680-664-1 |
| P2566 | ECHA Substance Infocard ID | 100.205.793 |
| P646 | Freebase ID | /m/07cqhf |
| P2062 | HSDB ID | 7288 |
| P234 | InChI | InChI=1S/C34H36F3NO13/c1-4-5-9-21(40)49-13-20(39)33(47)11-16-24(19(12-33)51-22-10-17(27(41)14(2)50-22)38-32(46)34(35,36)37)31(45)26-25(29(16)43)28(42)15-7-6-8-18(48-3)23(15)30(26)44/h6-8,14,17,19,22,27,41,43,45,47H,4-5,9-13H2,1-3H3,(H,38,46)/t14-,17-,19-,22-,27+,33-/m0/s1 |
| P235 | InChIKey | ZOCKGBMQLCSHFP-KQRAQHLDSA-N |
| P486 | MeSH descriptor ID | C016163 |
| P6366 | Microsoft Academic ID (discontinued) | 2778368998 |
| P2115 | NDF-RT ID | N0000148597 |
| P2840 | NSC number | 246131 |
| P11199 | Probes And Drugs ID | PD014197 |
| P662 | PubChem CID | 454216 |
| P3345 | RxNorm CUI | 31435 |
| P2877 | SureChEMBL ID | 12824 |
| P11089 | UniChem compound ID | 124816 |
| P652 | UNII | 2C6NUM6878 |
Why not click here or view trends?
log id: 10577163