Wikidata entity: Q7950808
C₁₆H₂₀FNO₂ (P274)
Quantities
| P2067 | mass | 277.148 |
| P233 | canonical SMILES | String | CN1C2CCC1C(C(C2)C3=CC=C(C=C3)F)C(=O)OC | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC=C(C=C3)F)C(=O)OC | ??? |
| P129 | physically interacts with | ... | Q2271947 (solute carrier family 6 member 3) | solute carrier family 6 member 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q899647 (dopamine reuptake inhibitor) | dopamine reuptake inhibitor |
| P231 | CAS Registry Number | 50370-56-4 |
| P683 | ChEBI ID | 232539 |
| P592 | ChEMBL ID | CHEMBL1944829 |
| P661 | ChemSpider ID | 94788 |
| P8494 | DSSTOX compound identifier | DTXCID60120915 |
| P3117 | DSSTox substance ID | DTXSID30198424 |
| P232 | EC number | 637-133-4 |
| P2566 | ECHA Substance Infocard ID | 100.164.866 |
| P646 | Freebase ID | /m/0c90bw |
| P595 | Guide to Pharmacology Ligand ID | 4606 |
| P595 | Guide to Pharmacology Ligand ID | 4605 |
| P234 | InChI | InChI=1S/C16H20FNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| P235 | InChIKey | QUSLQENMLDRCTO-YJNKXOJESA-N |
| P486 | MeSH descriptor ID | C021279 |
| P6366 | Microsoft Academic ID (discontinued) | 2778397249 |
| P3636 | PDB ligand ID | 42L |
| P638 | PDB structure ID | 4XPG |
| P11199 | Probes And Drugs ID | PD046594 |
| P662 | PubChem CID | 105056 |
| P2877 | SureChEMBL ID | 1573076 |
| P11089 | UniChem compound ID | 27221139 |
| P652 | UNII | 8ZT6KJ947T |
Why not click here or view trends?
log id: 5840271