Wikidata entity: Q8083976
C₉H₁₃N (P274)
Quantities
| P2067 | mass | 135.104799 |
| P233 | canonical SMILES | String | CC(CN)C1=CC=CC=C1 | ??? |
| P373 | Commons category | String | Beta-Methylphenethylamine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q11071075 (Trace amine associated receptor 1) | Trace amine associated receptor 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 582-22-9 |
| P683 | ChEBI ID | 229522 |
| P592 | ChEMBL ID | CHEMBL158578 |
| P661 | ChemSpider ID | 10920 |
| P3117 | DSSTox substance ID | DTXSID10870630 |
| P232 | EC number | 209-479-2 |
| P2566 | ECHA Substance Infocard ID | 100.008.619 |
| P646 | Freebase ID | /m/027_t5n |
| P595 | Guide to Pharmacology Ligand ID | 5510 |
| P234 | InChI | InChI=1S/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
| P235 | InChIKey | AXORVIZLPOGIRG-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2780230259 |
| P9405 | NMRShiftDB structure ID | 20208484 |
| P2840 | NSC number | 272273 |
| P11199 | Probes And Drugs ID | PD046620 |
| P662 | PubChem CID | 11398 |
| P2877 | SureChEMBL ID | 2107 |
| P11089 | UniChem compound ID | 202140 |
| P652 | UNII | 6XL7O3V13L |
Why not click here or view trends?
log id: 3574207