| P233 | canonical SMILES | C1=CNC(=C1)C(=O)N |
| P231 | CAS Registry Number | 4551-72-8 |
| P683 | ChEBI ID | 206279 |
| P8494 | DSSTOX compound identifier | DTXCID90292593 |
| P3117 | DSSTox substance ID | DTXSID10341512 |
| P234 | InChI | InChI=1S/C5H6N2O/c6-5(8)4-2-1-3-7-4/h1-3,7H,(H2,6,8) |
| P235 | InChIKey | RLOQBKJCOAXOLR-UHFFFAOYSA-N |
| P7746 | Natural Product Atlas ID | NPA022114 |
| P662 | PubChem CID | 573553 |
| P11089 | UniChem compound ID | 13882085 |
| P703 | found in taxon | Streptomyces | Q1144013 |
| Agelas oroides | Q3518062 | ||
| P2067 | mass | 110.048012812 |
| Q39841391 | Metabolomics-guided analysis of isocoumarin production by Streptomyces species MBT76 and biotransformation of flavonoids and phenylpropanoids |
| Q34548166 | Spoxazomicin D and Oxachelin C, Potent Neuroprotective Carboxamides from the Appalachian Coal Fire-Associated Isolate Streptomyces sp. RM-14-6. |
| Q104866989 | Two New Naturally Occurring Pyrrole Derivatives from the Tropical Marine SpongeAgelas oroides |
Search more.