Wikidata entity: Q82246509
C₂₉H₅₃NO₅ (P274)
Quantities
| P2067 | mass | 495.39237379599996 |
| P233 | canonical SMILES | String | CCCCCCCCCCCC(CC1OC(=O)C1CCCCCC)OC(=O)C(CC(C)C)NC=O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCCCCCCCCCC[C@@H](C[C@@H]1[C@@H](C(=O)O1)CCCCCC)OC(=O)[C@H](CC(C)C)NC=O | ??? |
| P3364 | stereoisomer of | ... | Q424163 (orlistat) | orlistat |
| P3364 | stereoisomer of | ... | Q27268718 ((-)-leucine orlistat) | (-)-leucine orlistat |
| P279 | subclass of | ... | Q126677825 (1-(3-Hexyl-4-oxooxetan-2-yl)tridecan-2-yl 2-formamido-4-methylpentanoate) | 1-(3-Hexyl-4-oxooxetan-2-yl)tridecan-2-yl 2-formamido-4-methylpentanoate |
| P231 | CAS Registry Number | 130193-42-9 |
| P8494 | DSSTOX compound identifier | DTXCID50383274 |
| P3117 | DSSTox substance ID | DTXSID80432446 |
| P234 | InChI | InChI=1S/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27+/m0/s1 |
| P235 | InChIKey | AHLBNYSZXLDEJQ-YIPNQBBMSA-N |
| P662 | PubChem CID | 9891992 |
| P11089 | UniChem compound ID | 33183400 |
| P652 | UNII | 9J9YPY4JKT |
Why not click here or view trends?
log id: 3299163